C13H19ClN2O — CID 61276094
2-amino-N-[2-(3-chlorophenyl)ethyl]pentanamide (PubChem CID 61276094) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is 2-amino-N-[2-(3-chlorophenyl)ethyl]pentanamide.
| Compound Name | 2-amino-N-[2-(3-chlorophenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 61276094 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-amino-N-[2-(3-chlorophenyl)ethyl]pentanamide |
| SMILES | CCCC(N)C(=O)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H19ClN2O/c1-2-4-12(15)13(17)16-8-7-10-5-3-6-11(14)9-10/h3,5-6,9,12H,2,4,7-8,15H2,1H3,(H,16,17) |
| InChIKey | ZHPYAEOCEXKVTH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |