C15H13ClFNO3 — CID 97060933
(3R)-N-(5-chloro-2-hydroxyphenyl)-3-(3-fluorophenyl)-3-hydroxypropanamide (PubChem CID 97060933) has the molecular formula C15H13ClFNO3 and a molecular weight of 309.72 g/mol. Its IUPAC name is (3R)-N-(5-chloro-2-hydroxyphenyl)-3-(3-fluorophenyl)-3-hydroxypropanamide.
| Compound Name | (3R)-N-(5-chloro-2-hydroxyphenyl)-3-(3-fluorophenyl)-3-hydroxypropanamide |
|---|---|
| PubChem CID | 97060933 |
| Molecular Formula | C15H13ClFNO3 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (3R)-N-(5-chloro-2-hydroxyphenyl)-3-(3-fluorophenyl)-3-hydroxypropanamide |
| SMILES | O=C(C[C@@H](O)c1cccc(F)c1)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H13ClFNO3/c16-10-4-5-13(19)12(7-10)18-15(21)8-14(20)9-2-1-3-11(17)6-9/h1-7,14,19-20H,8H2,(H,18,21)/t14-/m1/s1 |
| InChIKey | CZMIBWJVTCGJCO-CQSZACIVSA-N |
| XLogP | 3.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|