C15H13Cl2NO3 — CID 110026063
N-(3-chloro-4-hydroxyphenyl)-3-(4-chlorophenyl)-3-hydroxypropanamide (PubChem CID 110026063) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)-3-(4-chlorophenyl)-3-hydroxypropanamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)-3-(4-chlorophenyl)-3-hydroxypropanamide |
|---|---|
| PubChem CID | 110026063 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)-3-(4-chlorophenyl)-3-hydroxypropanamide |
| SMILES | O=C(CC(O)c1ccc(Cl)cc1)Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2NO3/c16-10-3-1-9(2-4-10)14(20)8-15(21)18-11-5-6-13(19)12(17)7-11/h1-7,14,19-20H,8H2,(H,18,21) |
| InChIKey | FBFDPASKRMIZFB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|