C11H9ClF3NO2 — CID 177486679
(E)-4-(5-chloro-2-hydroxyanilino)-1,1,1-trifluoropent-3-en-2-one (PubChem CID 177486679) has the molecular formula C11H9ClF3NO2 and a molecular weight of 279.65 g/mol. Its IUPAC name is (E)-4-(5-chloro-2-hydroxyanilino)-1,1,1-trifluoropent-3-en-2-one.
| Compound Name | (E)-4-(5-chloro-2-hydroxyanilino)-1,1,1-trifluoropent-3-en-2-one |
|---|---|
| PubChem CID | 177486679 |
| Molecular Formula | C11H9ClF3NO2 |
| Molecular Weight | 279.65 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | (E)-4-(5-chloro-2-hydroxyanilino)-1,1,1-trifluoropent-3-en-2-one |
| SMILES | C/C(=C\C(=O)C(F)(F)F)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C11H9ClF3NO2/c1-6(4-10(18)11(13,14)15)16-8-5-7(12)2-3-9(8)17/h2-5,16-17H,1H3/b6-4+ |
| InChIKey | RCWISAXKGLYFEF-GQCTYLIASA-N |
| XLogP | 3.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|