C19H22ClNO2 — CID 837870
(2S)-N-(5-chloro-2-hydroxyphenyl)-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 837870) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is (2S)-N-(5-chloro-2-hydroxyphenyl)-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | (2S)-N-(5-chloro-2-hydroxyphenyl)-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 837870 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (2S)-N-(5-chloro-2-hydroxyphenyl)-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | CC(C)Cc1ccc([C@H](C)C(=O)Nc2cc(Cl)ccc2O)cc1 |
| InChI | InChI=1S/C19H22ClNO2/c1-12(2)10-14-4-6-15(7-5-14)13(3)19(23)21-17-11-16(20)8-9-18(17)22/h4-9,11-13,22H,10H2,1-3H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | JHTULMNKLFLNTH-ZDUSSCGKSA-N |
| XLogP | 4.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|