C20H25NO2 — CID 7313981
(2S)-N-(2-hydroxy-4-methylphenyl)-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 7313981) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (2S)-N-(2-hydroxy-4-methylphenyl)-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | (2S)-N-(2-hydroxy-4-methylphenyl)-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 7313981 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (2S)-N-(2-hydroxy-4-methylphenyl)-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | Cc1ccc(NC(=O)[C@@H](C)c2ccc(CC(C)C)cc2)c(O)c1 |
| InChI | InChI=1S/C20H25NO2/c1-13(2)11-16-6-8-17(9-7-16)15(4)20(23)21-18-10-5-14(3)12-19(18)22/h5-10,12-13,15,22H,11H2,1-4H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | QILNOOMXJMRWDX-HNNXBMFYSA-N |
| XLogP | 4.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|