C18H25ClN6O3S — CID 147109405
3-[[4-chloro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 147109405) has the molecular formula C18H25ClN6O3S and a molecular weight of 440.96 g/mol. Its IUPAC name is 3-[[4-chloro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-[[4-chloro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 147109405 |
| Molecular Formula | C18H25ClN6O3S |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 3-[[4-chloro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | CC1(C)CC(Nc2nc(Cl)nc(Nc3cccc(S(=O)(=O)O)c3)n2)CC(C)(C)N1 |
| InChI | InChI=1S/C18H25ClN6O3S/c1-17(2)9-12(10-18(3,4)25-17)21-16-23-14(19)22-15(24-16)20-11-6-5-7-13(8-11)29(26,27)28/h5-8,12,25H,9-10H2,1-4H3,(H,26,27,28)(H2,20,21,22,23,24) |
| InChIKey | BMFATYQLPBBUTC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|