C16H23N7O5S2 — CID 90225262
3-[[4-amino-6-[[2-(methanesulfonamido)cyclohexyl]amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 90225262) has the molecular formula C16H23N7O5S2 and a molecular weight of 457.54 g/mol. Its IUPAC name is 3-[[4-amino-6-[[2-(methanesulfonamido)cyclohexyl]amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-[[4-amino-6-[[2-(methanesulfonamido)cyclohexyl]amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 90225262 |
| Molecular Formula | C16H23N7O5S2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 3-[[4-amino-6-[[2-(methanesulfonamido)cyclohexyl]amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | CS(=O)(=O)NC1CCCCC1Nc1nc(N)nc(Nc2cccc(S(=O)(=O)O)c2)n1 |
| InChI | InChI=1S/C16H23N7O5S2/c1-29(24,25)23-13-8-3-2-7-12(13)19-16-21-14(17)20-15(22-16)18-10-5-4-6-11(9-10)30(26,27)28/h4-6,9,12-13,23H,2-3,7-8H2,1H3,(H,26,27,28)(H4,17,18,19,20,21,22) |
| InChIKey | UIJIAYOGKJAHFI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 189.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|