C18H27N7O5S2 — CID 90225275
3-[[4-(dimethylamino)-6-[[3-(methanesulfonamido)cyclohexyl]amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 90225275) has the molecular formula C18H27N7O5S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-6-[[3-(methanesulfonamido)cyclohexyl]amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-[[4-(dimethylamino)-6-[[3-(methanesulfonamido)cyclohexyl]amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 90225275 |
| Molecular Formula | C18H27N7O5S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 3-[[4-(dimethylamino)-6-[[3-(methanesulfonamido)cyclohexyl]amino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | CN(C)c1nc(Nc2cccc(S(=O)(=O)O)c2)nc(NC2CCCC(NS(C)(=O)=O)C2)n1 |
| InChI | InChI=1S/C18H27N7O5S2/c1-25(2)18-22-16(19-12-6-4-8-14(10-12)24-31(3,26)27)21-17(23-18)20-13-7-5-9-15(11-13)32(28,29)30/h5,7,9,11-12,14,24H,4,6,8,10H2,1-3H3,(H,28,29,30)(H2,19,20,21,22,23) |
| InChIKey | QHNBSYAOGZCUCE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 166.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|