C18H15Cl2F3N6O4S — CID 53340217
3-[[4-(3,5-dichloroanilino)-1,3,5-triazin-2-yl]amino]-N-methylbenzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 53340217) has the molecular formula C18H15Cl2F3N6O4S and a molecular weight of 539.32 g/mol. Its IUPAC name is 3-[[4-(3,5-dichloroanilino)-1,3,5-triazin-2-yl]amino]-N-methylbenzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[4-(3,5-dichloroanilino)-1,3,5-triazin-2-yl]amino]-N-methylbenzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53340217 |
| Molecular Formula | C18H15Cl2F3N6O4S |
| Molecular Weight | 539.32 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | 3-[[4-(3,5-dichloroanilino)-1,3,5-triazin-2-yl]amino]-N-methylbenzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CNS(=O)(=O)c1cccc(Nc2ncnc(Nc3cc(Cl)cc(Cl)c3)n2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H14Cl2N6O2S.C2HF3O2/c1-19-27(25,26)14-4-2-3-12(8-14)22-15-20-9-21-16(24-15)23-13-6-10(17)5-11(18)7-13;3-2(4,5)1(6)7/h2-9,19H,1H3,(H2,20,21,22,23,24);(H,6,7) |
| InChIKey | OEGKKXOGBMYKGJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |