C15H19N7O10S2 — CID 59787568
2-[[4-(2-aminoethylamino)-6-[5-sulfo-2-(trioxidanylsulfanyl)anilino]-1,3,5-triazin-2-yl]-(1-hydroperoxyethenyl)amino]acetic acid (PubChem CID 59787568) has the molecular formula C15H19N7O10S2 and a molecular weight of 521.49 g/mol. Its IUPAC name is 2-[[4-(2-aminoethylamino)-6-[5-sulfo-2-(trioxidanylsulfanyl)anilino]-1,3,5-triazin-2-yl]-(1-hydroperoxyethenyl)amino]acetic acid.
| Compound Name | 2-[[4-(2-aminoethylamino)-6-[5-sulfo-2-(trioxidanylsulfanyl)anilino]-1,3,5-triazin-2-yl]-(1-hydroperoxyethenyl)amino]acetic acid |
|---|---|
| PubChem CID | 59787568 |
| Molecular Formula | C15H19N7O10S2 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 2-[[4-(2-aminoethylamino)-6-[5-sulfo-2-(trioxidanylsulfanyl)anilino]-1,3,5-triazin-2-yl]-(1-hydroperoxyethenyl)amino]acetic acid |
| SMILES | C=C(OO)N(CC(=O)O)c1nc(NCCN)nc(Nc2cc(S(=O)(=O)O)ccc2SOOO)n1 |
| InChI | InChI=1S/C15H19N7O10S2/c1-8(30-25)22(7-12(23)24)15-20-13(17-5-4-16)19-14(21-15)18-10-6-9(34(27,28)29)2-3-11(10)33-32-31-26/h2-3,6,25-26H,1,4-5,7,16H2,(H,23,24)(H,27,28,29)(H2,17,18,19,20,21) |
| InChIKey | VIQYLFQLBJQKPP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 251.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|