C20H23N7O9S3 — CID 59310206
7-[[4-[2-(1,1-dioxothiaziridin-2-yl)ethylamino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]naphthalene-1,3-disulfonic acid (PubChem CID 59310206) has the molecular formula C20H23N7O9S3 and a molecular weight of 601.65 g/mol. Its IUPAC name is 7-[[4-[2-(1,1-dioxothiaziridin-2-yl)ethylamino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-[[4-[2-(1,1-dioxothiaziridin-2-yl)ethylamino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 59310206 |
| Molecular Formula | C20H23N7O9S3 |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.07 |
| IUPAC Name | 7-[[4-[2-(1,1-dioxothiaziridin-2-yl)ethylamino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]naphthalene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2cc(Nc3nc(NCCN4CS4(=O)=O)nc(N4CCOCC4)n3)ccc2c1 |
| InChI | InChI=1S/C20H23N7O9S3/c28-37(29)12-27(37)4-3-21-18-23-19(25-20(24-18)26-5-7-36-8-6-26)22-14-2-1-13-9-15(38(30,31)32)11-17(16(13)10-14)39(33,34)35/h1-2,9-11H,3-8,12H2,(H,30,31,32)(H,33,34,35)(H2,21,22,23,24,25) |
| InChIKey | FXJNZOIXIIBPEV-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 221.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|