C25H25N7O12S3 — CID 142080268
5-[[4-(2,6-dimethylmorpholin-4-yl)-6-oxo-1H-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 142080268) has the molecular formula C25H25N7O12S3 and a molecular weight of 711.71 g/mol. Its IUPAC name is 5-[[4-(2,6-dimethylmorpholin-4-yl)-6-oxo-1H-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-[[4-(2,6-dimethylmorpholin-4-yl)-6-oxo-1H-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 142080268 |
| Molecular Formula | C25H25N7O12S3 |
| Molecular Weight | 711.71 g/mol |
| Exact Mass | 711.07 |
| IUPAC Name | 5-[[4-(2,6-dimethylmorpholin-4-yl)-6-oxo-1H-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | CC1CN(c2nc(Nc3cc(S(=O)(=O)O)cc4cc(S(=O)(=O)O)c(/N=N/c5ccccc5S(=O)(=O)O)c(O)c34)[nH]c(=O)n2)CC(C)O1 |
| InChI | InChI=1S/C25H25N7O12S3/c1-12-10-32(11-13(2)44-12)24-27-23(28-25(34)29-24)26-17-9-15(45(35,36)37)7-14-8-19(47(41,42)43)21(22(33)20(14)17)31-30-16-5-3-4-6-18(16)46(38,39)40/h3-9,12-13,33H,10-11H2,1-2H3,(H,35,36,37)(H,38,39,40)(H,41,42,43)(H2,26,27,28,29,34)/b31-30+ |
| InChIKey | FUYJWCLTSQATID-NVQSTNCTSA-N |
| XLogP | 2.54 |
| TPSA | 291.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.71 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|