C26H20N7O10S3-3 — CID 135787838
5-[[4-(ethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(1-sulfonatonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonate (PubChem CID 135787838) has the molecular formula C26H20N7O10S3-3 and a molecular weight of 686.69 g/mol. Its IUPAC name is 5-[[4-(ethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(1-sulfonatonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonate.
| Compound Name | 5-[[4-(ethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(1-sulfonatonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 135787838 |
| Molecular Formula | C26H20N7O10S3-3 |
| Molecular Weight | 686.69 g/mol |
| Exact Mass | 686.05 |
| IUPAC Name | 5-[[4-(ethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(1-sulfonatonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonate |
| SMILES | CCNc1nc(C)nc(Nc2cc(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])c(/N=N/c4ccc5ccccc5c4S(=O)(=O)[O-])c(O)c23)n1 |
| InChI | InChI=1S/C26H23N7O10S3/c1-3-27-25-28-13(2)29-26(31-25)30-19-12-16(44(35,36)37)10-15-11-20(45(38,39)40)22(23(34)21(15)19)33-32-18-9-8-14-6-4-5-7-17(14)24(18)46(41,42)43/h4-12,34H,3H2,1-2H3,(H,35,36,37)(H,38,39,40)(H,41,42,43)(H2,27,28,29,30,31)/p-3/b33-32+ |
| InChIKey | IIBSFPPUGSHCJN-ULIFNZDWSA-K |
| XLogP | 3.50 |
| TPSA | 279.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|