C28H23ClFN7O10S3 — CID 136504341
5-[[4-chloro-6-(N-ethyl-3-methylanilino)-1,3,5-triazin-2-yl]amino]-3-[(4-fluoro-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136504341) has the molecular formula C28H23ClFN7O10S3 and a molecular weight of 768.18 g/mol. Its IUPAC name is 5-[[4-chloro-6-(N-ethyl-3-methylanilino)-1,3,5-triazin-2-yl]amino]-3-[(4-fluoro-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 5-[[4-chloro-6-(N-ethyl-3-methylanilino)-1,3,5-triazin-2-yl]amino]-3-[(4-fluoro-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136504341 |
| Molecular Formula | C28H23ClFN7O10S3 |
| Molecular Weight | 768.18 g/mol |
| Exact Mass | 767.03 |
| IUPAC Name | 5-[[4-chloro-6-(N-ethyl-3-methylanilino)-1,3,5-triazin-2-yl]amino]-3-[(4-fluoro-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | CCN(c1cccc(C)c1)c1nc(Cl)nc(Nc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc(F)cc4S(=O)(=O)O)c(O)c23)n1 |
| InChI | InChI=1S/C28H23ClFN7O10S3/c1-3-37(17-6-4-5-14(2)9-17)28-33-26(29)32-27(34-28)31-20-13-18(48(39,40)41)10-15-11-22(50(45,46)47)24(25(38)23(15)20)36-35-19-8-7-16(30)12-21(19)49(42,43)44/h4-13,38H,3H2,1-2H3,(H,39,40,41)(H,42,43,44)(H,45,46,47)(H,31,32,33,34)/b36-35+ |
| InChIKey | PIXXZTVXYRAETR-ULDVOPSXSA-N |
| XLogP | 5.89 |
| TPSA | 262.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.18 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|