C52H36Cl2N14NaO20S6 — CID 173062797
CID 173062797 (PubChem CID 173062797) has the molecular formula C52H36Cl2N14NaO20S6 and a molecular weight of 1463.24 g/mol.
| Compound Name | CID 173062797 |
|---|---|
| PubChem CID | 173062797 |
| Molecular Formula | C52H36Cl2N14NaO20S6 |
| Molecular Weight | 1463.24 g/mol |
| Exact Mass | 1460.98 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(Nc2nc(Cl)nc(Nc3c(S(=O)(=O)O)ccc4c(S(=O)(=O)O)cc(/N=N/c5ccccc5)c(O)c34)n2)ccc1C=Cc1ccc(Nc2nc(Cl)nc(Nc3c(S(=O)(=O)O)ccc4c(S(=O)(=O)O)cc(/N=N/c5ccccc5)c(O)c34)n2)cc1S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C52H36Cl2N14O20S6.Na/c53-47-59-49(63-51(61-47)57-43-35(89(71,72)73)19-17-31-39(93(83,84)85)23-33(45(69)41(31)43)67-65-27-7-3-1-4-8-27)55-29-15-13-25(37(21-29)91(77,78)79)11-12-26-14-16-30(22-38(26)92(80,81)82)56-50-60-48(54)62-52(64-50)58-44-36(90(74,75)76)20-18-32-40(94(86,87)88)24-34(46(70)42(32)44)68-66-28-9-5-2-6-10-28;/h1-24,69-70H,(H,71,72,73)(H,74,75,76)(H,77,78,79)(H,80,81,82)(H,83,84,85)(H,86,87,88)(H2,55,57,59,61,63)(H2,56,58,60,62,64);/b12-11?,67-65+,68-66+; |
| InChIKey | WBJVCTJMURSDHH-PWSDNAPJSA-N |
| XLogP | 10.16 |
| TPSA | 541.58 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 95 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1463.24 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|