C22H16F3N2NaO6S — CID 173019630
sodium;1-amino-4-[4-methoxy-3-(trifluoromethyl)anilino]-9,10-dioxoanthracene-2-sulfonic acid;hydride (PubChem CID 173019630) has the molecular formula C22H16F3N2NaO6S and a molecular weight of 516.43 g/mol. Its IUPAC name is sodium;1-amino-4-[4-methoxy-3-(trifluoromethyl)anilino]-9,10-dioxoanthracene-2-sulfonic acid;hydride.
| Compound Name | sodium;1-amino-4-[4-methoxy-3-(trifluoromethyl)anilino]-9,10-dioxoanthracene-2-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173019630 |
| Molecular Formula | C22H16F3N2NaO6S |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | sodium;1-amino-4-[4-methoxy-3-(trifluoromethyl)anilino]-9,10-dioxoanthracene-2-sulfonic acid;hydride |
| SMILES | COc1ccc(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)cc1C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C22H15F3N2O6S.Na.H/c1-33-15-7-6-10(8-13(15)22(23,24)25)27-14-9-16(34(30,31)32)19(26)18-17(14)20(28)11-4-2-3-5-12(11)21(18)29;;/h2-9,27H,26H2,1H3,(H,30,31,32);;/q;+1;-1 |
| InChIKey | CKWBZUIHWVNOHZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|