C12H15BrN2OS — CID 103708503
5-bromo-N-(3-methylsulfanylcyclopentyl)pyridine-3-carboxamide (PubChem CID 103708503) has the molecular formula C12H15BrN2OS and a molecular weight of 315.24 g/mol. Its IUPAC name is 5-bromo-N-(3-methylsulfanylcyclopentyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(3-methylsulfanylcyclopentyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103708503 |
| Molecular Formula | C12H15BrN2OS |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 5-bromo-N-(3-methylsulfanylcyclopentyl)pyridine-3-carboxamide |
| SMILES | CSC1CCC(NC(=O)c2cncc(Br)c2)C1 |
| InChI | InChI=1S/C12H15BrN2OS/c1-17-11-3-2-10(5-11)15-12(16)8-4-9(13)7-14-6-8/h4,6-7,10-11H,2-3,5H2,1H3,(H,15,16) |
| InChIKey | ZRGFOFMTWVQCSG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |