C22H34N4O2S — CID 11937143
N-[(2S)-1-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-methylbenzamide (PubChem CID 11937143) has the molecular formula C22H34N4O2S and a molecular weight of 418.61 g/mol. Its IUPAC name is N-[(2S)-1-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-methylbenzamide.
| Compound Name | N-[(2S)-1-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 11937143 |
| Molecular Formula | C22H34N4O2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-[(2S)-1-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N[C@H](C(=O)NNC(=S)N[C@H]1CCC[C@@H](C)[C@@H]1C)C(C)C |
| InChI | InChI=1S/C22H34N4O2S/c1-13(2)19(24-20(27)17-11-7-6-9-15(17)4)21(28)25-26-22(29)23-18-12-8-10-14(3)16(18)5/h6-7,9,11,13-14,16,18-19H,8,10,12H2,1-5H3,(H,24,27)(H,25,28)(H2,23,26,29)/t14-,16+,18+,19+/m1/s1 |
| InChIKey | JXYVHGGOOTVBNC-XIVBQZFQSA-N |
| XLogP | 3.07 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|