C20H31N3OS — CID 11946404
1-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-3-[[(2R)-2-phenylpentanoyl]amino]thiourea (PubChem CID 11946404) has the molecular formula C20H31N3OS and a molecular weight of 361.56 g/mol. Its IUPAC name is 1-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-3-[[(2R)-2-phenylpentanoyl]amino]thiourea.
| Compound Name | 1-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-3-[[(2R)-2-phenylpentanoyl]amino]thiourea |
|---|---|
| PubChem CID | 11946404 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-3-[[(2R)-2-phenylpentanoyl]amino]thiourea |
| SMILES | CCC[C@@H](C(=O)NNC(=S)N[C@H]1CCC[C@H](C)[C@@H]1C)c1ccccc1 |
| InChI | InChI=1S/C20H31N3OS/c1-4-9-17(16-11-6-5-7-12-16)19(24)22-23-20(25)21-18-13-8-10-14(2)15(18)3/h5-7,11-12,14-15,17-18H,4,8-10,13H2,1-3H3,(H,22,24)(H2,21,23,25)/t14-,15-,17+,18-/m0/s1 |
| InChIKey | SUQLSKCCBCLRDF-ONIAQPFYSA-N |
| XLogP | 3.89 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|