C20H30N4O2S — CID 11946157
N-[(1S)-3-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-oxo-1-phenylpropyl]acetamide (PubChem CID 11946157) has the molecular formula C20H30N4O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is N-[(1S)-3-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-oxo-1-phenylpropyl]acetamide.
| Compound Name | N-[(1S)-3-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-oxo-1-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 11946157 |
| Molecular Formula | C20H30N4O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[(1S)-3-[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-3-oxo-1-phenylpropyl]acetamide |
| SMILES | CC(=O)N[C@@H](CC(=O)NNC(=S)N[C@@H]1CCC[C@@H](C)[C@H]1C)c1ccccc1 |
| InChI | InChI=1S/C20H30N4O2S/c1-13-8-7-11-17(14(13)2)22-20(27)24-23-19(26)12-18(21-15(3)25)16-9-5-4-6-10-16/h4-6,9-10,13-14,17-18H,7-8,11-12H2,1-3H3,(H,21,25)(H,23,26)(H2,22,24,27)/t13-,14-,17-,18+/m1/s1 |
| InChIKey | XMKGWQCPULOACC-DTDBQYNISA-N |
| XLogP | 2.57 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|