C24H30N2O2 — CID 56827734
N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 56827734) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 56827734 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | CC1CCCC(NC(=O)CC(NC(=O)c2ccccc2)c2ccccc2)C1C |
| InChI | InChI=1S/C24H30N2O2/c1-17-10-9-15-21(18(17)2)25-23(27)16-22(19-11-5-3-6-12-19)26-24(28)20-13-7-4-8-14-20/h3-8,11-14,17-18,21-22H,9-10,15-16H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | JPHZOCNNWDCUCN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |