C18H28N4S3 — CID 11936534
1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea (PubChem CID 11936534) has the molecular formula C18H28N4S3 and a molecular weight of 396.65 g/mol. Its IUPAC name is 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea.
| Compound Name | 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 11936534 |
| Molecular Formula | C18H28N4S3 |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=S)NNC(=S)NCCSc1ccccc1 |
| InChI | InChI=1S/C18H28N4S3/c1-13-7-6-10-16(14(13)2)20-18(24)22-21-17(23)19-11-12-25-15-8-4-3-5-9-15/h3-5,8-9,13-14,16H,6-7,10-12H2,1-2H3,(H2,19,21,23)(H2,20,22,24)/t13-,14-,16-/m1/s1 |
| InChIKey | QRNPEYDLUFRLPX-IIAWOOMASA-N |
| XLogP | 3.45 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|