C9H16N2S — CID 98080408
1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylthiourea (PubChem CID 98080408) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylthiourea.
| Compound Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylthiourea |
|---|---|
| PubChem CID | 98080408 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylthiourea |
| SMILES | CNC(=S)N[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C9H16N2S/c1-10-9(12)11-8-5-6-2-3-7(8)4-6/h6-8H,2-5H2,1H3,(H2,10,11,12)/t6-,7-,8+/m1/s1 |
| InChIKey | RCPRDNHLNDSTGX-PRJMDXOYSA-N |
| XLogP | 1.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|