C12H22N2OS — CID 98387969
1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-1-hydroxybutan-2-yl]thiourea (PubChem CID 98387969) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-1-hydroxybutan-2-yl]thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-1-hydroxybutan-2-yl]thiourea |
|---|---|
| PubChem CID | 98387969 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-1-hydroxybutan-2-yl]thiourea |
| SMILES | CC[C@H](CO)NC(=S)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C12H22N2OS/c1-2-10(7-15)13-12(16)14-11-6-8-3-4-9(11)5-8/h8-11,15H,2-7H2,1H3,(H2,13,14,16)/t8-,9-,10+,11-/m0/s1 |
| InChIKey | YQMXYJDDIUYATG-MMWGEVLESA-N |
| XLogP | 1.41 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|