C17H24N2O2S — CID 98844769
1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]thiourea (PubChem CID 98844769) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]thiourea.
| Compound Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]thiourea |
|---|---|
| PubChem CID | 98844769 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]thiourea |
| SMILES | OC[C@H](Cc1ccc(O)cc1)NC(=S)N[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H24N2O2S/c20-10-14(8-11-2-5-15(21)6-3-11)18-17(22)19-16-9-12-1-4-13(16)7-12/h2-3,5-6,12-14,16,20-21H,1,4,7-10H2,(H2,18,19,22)/t12-,13-,14-,16+/m0/s1 |
| InChIKey | UNPWXFFUDYDRND-RZLSGREXSA-N |
| XLogP | 1.95 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|