About (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol
(2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol (PubChem CID 124526679) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol |
| PubChem CID | 124526679 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol |
| SMILES | CC[C@H](CO)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C11H21NO/c1-2-10(7-13)12-11-6-8-3-4-9(11)5-8/h8-13H,2-7H2,1H3/t8-,9-,10+,11-/m0/s1 |
| InChIKey | FYFJUBHVTOMMRD-MMWGEVLESA-N |
| XLogP | 1.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol?
The IUPAC name of (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol (CID 124526679) is (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol.
What is the SMILES notation for (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol?
The canonical SMILES for (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol is CC[C@H](CO)N[C@H]1C[C@H]2CC[C@H]1C2.
What is the InChIKey of (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol?
The InChIKey is FYFJUBHVTOMMRD-MMWGEVLESA-N. The full InChI is InChI=1S/C11H21NO/c1-2-10(7-13)12-11-6-8-3-4-9(11)5-8/h8-13H,2-7H2,1H3/t8-,9-,10+,11-/m0/s1.
What are the key properties of (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol?
(2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol has a molecular weight of 183.29 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]butan-1-ol is sourced from PubChem (CID 124526679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).