C14H25NO — CID 103922588
(2R)-2-(8-tricyclo[5.2.1.02,6]decanylamino)butan-1-ol (PubChem CID 103922588) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (2R)-2-(8-tricyclo[5.2.1.02,6]decanylamino)butan-1-ol.
| Compound Name | (2R)-2-(8-tricyclo[5.2.1.02,6]decanylamino)butan-1-ol |
|---|---|
| PubChem CID | 103922588 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (2R)-2-(8-tricyclo[5.2.1.02,6]decanylamino)butan-1-ol |
| SMILES | CC[C@H](CO)NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C14H25NO/c1-2-10(8-16)15-14-7-9-6-13(14)12-5-3-4-11(9)12/h9-16H,2-8H2,1H3/t9?,10-,11?,12?,13?,14?/m1/s1 |
| InChIKey | TYXAGJXIWMKPNO-CCDBMKQKSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |