C13H23N — CID 124708771
(1R,2S,6R,7S,8R)-N-propyltricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 124708771) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (1R,2S,6R,7S,8R)-N-propyltricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | (1R,2S,6R,7S,8R)-N-propyltricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 124708771 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (1R,2S,6R,7S,8R)-N-propyltricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | CCCN[C@@H]1C[C@H]2C[C@H]1[C@@H]1CCC[C@@H]21 |
| InChI | InChI=1S/C13H23N/c1-2-6-14-13-8-9-7-12(13)11-5-3-4-10(9)11/h9-14H,2-8H2,1H3/t9-,10+,11-,12+,13-/m1/s1 |
| InChIKey | BXSOLIKATCOOBM-RXGFPQBGSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |