C17H33N — CID 64730144
2-(3,5-dimethylcyclohexyl)-N-propylcyclohexan-1-amine (PubChem CID 64730144) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohexyl)-N-propylcyclohexan-1-amine.
| Compound Name | 2-(3,5-dimethylcyclohexyl)-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64730144 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | 2-(3,5-dimethylcyclohexyl)-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCCCC1C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C17H33N/c1-4-9-18-17-8-6-5-7-16(17)15-11-13(2)10-14(3)12-15/h13-18H,4-12H2,1-3H3 |
| InChIKey | HIZURJCACZPOFX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |