C15H27NS — CID 115886378
N-(4-methylsulfanylbutyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 115886378) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is N-(4-methylsulfanylbutyl)tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | N-(4-methylsulfanylbutyl)tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 115886378 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | N-(4-methylsulfanylbutyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | CSCCCCNC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C15H27NS/c1-17-8-3-2-7-16-15-10-11-9-14(15)13-6-4-5-12(11)13/h11-16H,2-10H2,1H3 |
| InChIKey | KOBSNMNORNEIDQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|