About 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide
2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide (PubChem CID 43402411) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide.
Molecular Properties
| Compound Name | 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide |
| PubChem CID | 43402411 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide |
| SMILES | CC(NC1CC2CC1C1CCCC21)C(N)=O |
| InChI | InChI=1S/C13H22N2O/c1-7(13(14)16)15-12-6-8-5-11(12)10-4-2-3-9(8)10/h7-12,15H,2-6H2,1H3,(H2,14,16) |
| InChIKey | XCKCRQPMDQGFKC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide?
The IUPAC name of 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide (CID 43402411) is 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide.
What is the SMILES notation for 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide?
The canonical SMILES for 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide is CC(NC1CC2CC1C1CCCC21)C(N)=O.
What is the InChIKey of 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide?
The InChIKey is XCKCRQPMDQGFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O/c1-7(13(14)16)15-12-6-8-5-11(12)10-4-2-3-9(8)10/h7-12,15H,2-6H2,1H3,(H2,14,16).
What are the key properties of 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide?
2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide has a molecular weight of 222.33 g/mol, XLogP of 1.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-tricyclo[5.2.1.02,6]decanylamino)propanamide is sourced from PubChem (CID 43402411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).