C13H20ClNO — CID 43700055
2-chloro-N-(8-tricyclo[5.2.1.02,6]decanyl)propanamide (PubChem CID 43700055) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 2-chloro-N-(8-tricyclo[5.2.1.02,6]decanyl)propanamide.
| Compound Name | 2-chloro-N-(8-tricyclo[5.2.1.02,6]decanyl)propanamide |
|---|---|
| PubChem CID | 43700055 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-chloro-N-(8-tricyclo[5.2.1.02,6]decanyl)propanamide |
| SMILES | CC(Cl)C(=O)NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C13H20ClNO/c1-7(14)13(16)15-12-6-8-5-11(12)10-4-2-3-9(8)10/h7-12H,2-6H2,1H3,(H,15,16) |
| InChIKey | GPNLBQWPVPLAGE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|