C18H24N2O3 — CID 124734053
N-[(2S)-1-oxo-1-[[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]propan-2-yl]furan-3-carboxamide (PubChem CID 124734053) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[(2S)-1-oxo-1-[[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]propan-2-yl]furan-3-carboxamide.
| Compound Name | N-[(2S)-1-oxo-1-[[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]propan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 124734053 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[(2S)-1-oxo-1-[[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]propan-2-yl]furan-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccoc1)C(=O)N[C@@H]1C[C@H]2C[C@H]1[C@H]1CCC[C@H]21 |
| InChI | InChI=1S/C18H24N2O3/c1-10(19-18(22)11-5-6-23-9-11)17(21)20-16-8-12-7-15(16)14-4-2-3-13(12)14/h5-6,9-10,12-16H,2-4,7-8H2,1H3,(H,19,22)(H,20,21)/t10-,12+,13+,14-,15-,16+/m0/s1 |
| InChIKey | LVQIAQOMBJLWTO-GGLKYNNCSA-N |
| XLogP | 2.34 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |