C19H33N3O — CID 124864947
1-(1-propan-2-ylpiperidin-4-yl)-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea (PubChem CID 124864947) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-(1-propan-2-ylpiperidin-4-yl)-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea.
| Compound Name | 1-(1-propan-2-ylpiperidin-4-yl)-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
|---|---|
| PubChem CID | 124864947 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | 1-(1-propan-2-ylpiperidin-4-yl)-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
| SMILES | CC(C)N1CCC(NC(=O)N[C@@H]2C[C@H]3C[C@H]2[C@@H]2CCC[C@@H]32)CC1 |
| InChI | InChI=1S/C19H33N3O/c1-12(2)22-8-6-14(7-9-22)20-19(23)21-18-11-13-10-17(18)16-5-3-4-15(13)16/h12-18H,3-11H2,1-2H3,(H2,20,21,23)/t13-,15+,16-,17+,18-/m1/s1 |
| InChIKey | KUBFXYBUNCITKH-QRIFCXAISA-N |
| XLogP | 2.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |