About 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide
2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide (PubChem CID 78858492) has the molecular formula C16H27NOS
and a molecular weight of 281.46 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide.
Molecular Properties
| Compound Name | 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide |
| PubChem CID | 78858492 |
| Molecular Formula | C16H27NOS |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide |
| SMILES | CC(C)(C)SCC(=O)NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C16H27NOS/c1-16(2,3)19-9-15(18)17-14-8-10-7-13(14)12-6-4-5-11(10)12/h10-14H,4-9H2,1-3H3,(H,17,18) |
| InChIKey | MWCHOQXSVMWEIA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
The IUPAC name of 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide (CID 78858492) is 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide.
What is the SMILES notation for 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
The canonical SMILES for 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide is CC(C)(C)SCC(=O)NC1CC2CC1C1CCCC21.
What is the InChIKey of 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
The InChIKey is MWCHOQXSVMWEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NOS/c1-16(2,3)19-9-15(18)17-14-8-10-7-13(14)12-6-4-5-11(10)12/h10-14H,4-9H2,1-3H3,(H,17,18).
What are the key properties of 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide has a molecular weight of 281.46 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylsulfanyl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide is sourced from PubChem (CID 78858492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).