C17H25NO — CID 43066745
2-cyclopent-2-en-1-yl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide (PubChem CID 43066745) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide |
|---|---|
| PubChem CID | 43066745 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide |
| SMILES | O=C(CC1C=CCC1)NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H25NO/c19-17(8-11-4-1-2-5-11)18-16-10-12-9-15(16)14-7-3-6-13(12)14/h1,4,11-16H,2-3,5-10H2,(H,18,19) |
| InChIKey | YYTBDIPSADCVER-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|