C17H29NO3S — CID 124729848
3-(2-methylpropylsulfonyl)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide (PubChem CID 124729848) has the molecular formula C17H29NO3S and a molecular weight of 327.49 g/mol. Its IUPAC name is 3-(2-methylpropylsulfonyl)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide.
| Compound Name | 3-(2-methylpropylsulfonyl)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide |
|---|---|
| PubChem CID | 124729848 |
| Molecular Formula | C17H29NO3S |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 3-(2-methylpropylsulfonyl)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide |
| SMILES | CC(C)CS(=O)(=O)CCC(=O)N[C@@H]1C[C@H]2C[C@H]1[C@@H]1CCC[C@@H]21 |
| InChI | InChI=1S/C17H29NO3S/c1-11(2)10-22(20,21)7-6-17(19)18-16-9-12-8-15(16)14-5-3-4-13(12)14/h11-16H,3-10H2,1-2H3,(H,18,19)/t12-,13+,14-,15+,16-/m1/s1 |
| InChIKey | GUDDRMROGUBYKW-DGADGQDISA-N |
| XLogP | 2.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |