C15H26N2O — CID 43710212
2-amino-N-(8-tricyclo[5.2.1.02,6]decanyl)pentanamide (PubChem CID 43710212) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-amino-N-(8-tricyclo[5.2.1.02,6]decanyl)pentanamide.
| Compound Name | 2-amino-N-(8-tricyclo[5.2.1.02,6]decanyl)pentanamide |
|---|---|
| PubChem CID | 43710212 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 2-amino-N-(8-tricyclo[5.2.1.02,6]decanyl)pentanamide |
| SMILES | CCCC(N)C(=O)NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C15H26N2O/c1-2-4-13(16)15(18)17-14-8-9-7-12(14)11-6-3-5-10(9)11/h9-14H,2-8,16H2,1H3,(H,17,18) |
| InChIKey | FELFKUJQQLEGLH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |