C13H17F4NO — CID 103732570
2,2,3,3-tetrafluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)propanamide (PubChem CID 103732570) has the molecular formula C13H17F4NO and a molecular weight of 279.28 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)propanamide |
|---|---|
| PubChem CID | 103732570 |
| Molecular Formula | C13H17F4NO |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)propanamide |
| SMILES | O=C(NC1CC2CC1C1CCCC21)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H17F4NO/c14-11(15)13(16,17)12(19)18-10-5-6-4-9(10)8-3-1-2-7(6)8/h6-11H,1-5H2,(H,18,19) |
| InChIKey | XXJYVRGBTNAHNV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|