C14H22F2N2O — CID 124855575
N-(2,2-difluoroethyl)-2-[[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]acetamide (PubChem CID 124855575) has the molecular formula C14H22F2N2O and a molecular weight of 272.34 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-[[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]acetamide.
| Compound Name | N-(2,2-difluoroethyl)-2-[[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]acetamide |
|---|---|
| PubChem CID | 124855575 |
| Molecular Formula | C14H22F2N2O |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-[[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]amino]acetamide |
| SMILES | O=C(CN[C@@H]1C[C@H]2C[C@H]1[C@@H]1CCC[C@H]21)NCC(F)F |
| InChI | InChI=1S/C14H22F2N2O/c15-13(16)6-18-14(19)7-17-12-5-8-4-11(12)10-3-1-2-9(8)10/h8-13,17H,1-7H2,(H,18,19)/t8-,9-,10-,11+,12-/m1/s1 |
| InChIKey | ZHPGHYBTGZPEIB-PZWNZHSQSA-N |
| XLogP | 1.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |