C20H27NO2S — CID 124859152
(2R)-2-(4-methylsulfanylphenoxy)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide (PubChem CID 124859152) has the molecular formula C20H27NO2S and a molecular weight of 345.51 g/mol. Its IUPAC name is (2R)-2-(4-methylsulfanylphenoxy)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide.
| Compound Name | (2R)-2-(4-methylsulfanylphenoxy)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide |
|---|---|
| PubChem CID | 124859152 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (2R)-2-(4-methylsulfanylphenoxy)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide |
| SMILES | CSc1ccc(O[C@H](C)C(=O)N[C@@H]2C[C@H]3C[C@H]2[C@@H]2CCC[C@@H]32)cc1 |
| InChI | InChI=1S/C20H27NO2S/c1-12(23-14-6-8-15(24-2)9-7-14)20(22)21-19-11-13-10-18(19)17-5-3-4-16(13)17/h6-9,12-13,16-19H,3-5,10-11H2,1-2H3,(H,21,22)/t12-,13-,16+,17-,18+,19-/m1/s1 |
| InChIKey | WGGFEESJCVWXHD-NFXQELDMSA-N |
| XLogP | 4.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |