C16H19F4NO2 — CID 43046803
2-(4-fluorophenoxy)-N-[2-(trifluoromethyl)cyclohexyl]propanamide (PubChem CID 43046803) has the molecular formula C16H19F4NO2 and a molecular weight of 333.32 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[2-(trifluoromethyl)cyclohexyl]propanamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[2-(trifluoromethyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 43046803 |
| Molecular Formula | C16H19F4NO2 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[2-(trifluoromethyl)cyclohexyl]propanamide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C16H19F4NO2/c1-10(23-12-8-6-11(17)7-9-12)15(22)21-14-5-3-2-4-13(14)16(18,19)20/h6-10,13-14H,2-5H2,1H3,(H,21,22) |
| InChIKey | BCNMANCLKGXUMF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |