C17H34N5OS2+ — CID 11933350
1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)thiourea (PubChem CID 11933350) has the molecular formula C17H34N5OS2+ and a molecular weight of 388.63 g/mol. Its IUPAC name is 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)thiourea.
| Compound Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 11933350 |
| Molecular Formula | C17H34N5OS2+ |
| Molecular Weight | 388.63 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=S)NNC(=S)NCCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C17H33N5OS2/c1-13-5-3-6-15(14(13)2)19-17(25)21-20-16(24)18-7-4-8-22-9-11-23-12-10-22/h13-15H,3-12H2,1-2H3,(H2,18,20,24)(H2,19,21,25)/p+1/t13-,14-,15+/m1/s1 |
| InChIKey | HSHKBIGQJKKKOU-KFWWJZLASA-O |
| XLogP | -0.04 |
| TPSA | 61.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.63 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|