C15H28N4OS2 — CID 11933358
1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]thiourea (PubChem CID 11933358) has the molecular formula C15H28N4OS2 and a molecular weight of 344.55 g/mol. Its IUPAC name is 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]thiourea.
| Compound Name | 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]thiourea |
|---|---|
| PubChem CID | 11933358 |
| Molecular Formula | C15H28N4OS2 |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=S)NNC(=S)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H28N4OS2/c1-10-5-3-7-13(11(10)2)17-15(22)19-18-14(21)16-9-12-6-4-8-20-12/h10-13H,3-9H2,1-2H3,(H2,16,18,21)(H2,17,19,22)/t10-,11-,12+,13-/m1/s1 |
| InChIKey | PBVUXOXNUKTXGT-FVCCEPFGSA-N |
| XLogP | 1.83 |
| TPSA | 57.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|