C15H23N3O2S2 — CID 8654744
1-[[2-(3,5-dimethylphenoxy)acetyl]amino]-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 8654744) has the molecular formula C15H23N3O2S2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 1-[[2-(3,5-dimethylphenoxy)acetyl]amino]-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-[[2-(3,5-dimethylphenoxy)acetyl]amino]-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 8654744 |
| Molecular Formula | C15H23N3O2S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-[[2-(3,5-dimethylphenoxy)acetyl]amino]-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CSCCCNC(=S)NNC(=O)COc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C15H23N3O2S2/c1-11-7-12(2)9-13(8-11)20-10-14(19)17-18-15(21)16-5-4-6-22-3/h7-9H,4-6,10H2,1-3H3,(H,17,19)(H2,16,18,21) |
| InChIKey | IZOOSNMBFTYNAS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|