C14H21N3O3S2 — CID 8625064
1-[(3,4-dimethoxybenzoyl)amino]-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 8625064) has the molecular formula C14H21N3O3S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-[(3,4-dimethoxybenzoyl)amino]-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-[(3,4-dimethoxybenzoyl)amino]-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 8625064 |
| Molecular Formula | C14H21N3O3S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 1-[(3,4-dimethoxybenzoyl)amino]-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | COc1ccc(C(=O)NNC(=S)NCCCSC)cc1OC |
| InChI | InChI=1S/C14H21N3O3S2/c1-19-11-6-5-10(9-12(11)20-2)13(18)16-17-14(21)15-7-4-8-22-3/h5-6,9H,4,7-8H2,1-3H3,(H,16,18)(H2,15,17,21) |
| InChIKey | WJHFXMDCGQYDTE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|