C14H20N4O3S — CID 2381772
4-[2-(2-morpholin-4-ium-4-ylethylcarbamothioyl)hydrazinyl]benzoate (PubChem CID 2381772) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is 4-[2-(2-morpholin-4-ium-4-ylethylcarbamothioyl)hydrazinyl]benzoate.
| Compound Name | 4-[2-(2-morpholin-4-ium-4-ylethylcarbamothioyl)hydrazinyl]benzoate |
|---|---|
| PubChem CID | 2381772 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-[2-(2-morpholin-4-ium-4-ylethylcarbamothioyl)hydrazinyl]benzoate |
| SMILES | O=C([O-])c1ccc(NNC(=S)NCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C14H20N4O3S/c19-13(20)11-1-3-12(4-2-11)16-17-14(22)15-5-6-18-7-9-21-10-8-18/h1-4,16H,5-10H2,(H,19,20)(H2,15,17,22) |
| InChIKey | WHPXQZSWHOOZQP-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|