C20H26N3O4S+ — CID 7392696
4-[(4-methylphenyl)sulfamoyl]-N-(2-morpholin-4-ium-4-ylethyl)benzamide (PubChem CID 7392696) has the molecular formula C20H26N3O4S+ and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-[(4-methylphenyl)sulfamoyl]-N-(2-morpholin-4-ium-4-ylethyl)benzamide.
| Compound Name | 4-[(4-methylphenyl)sulfamoyl]-N-(2-morpholin-4-ium-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 7392696 |
| Molecular Formula | C20H26N3O4S+ |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 4-[(4-methylphenyl)sulfamoyl]-N-(2-morpholin-4-ium-4-ylethyl)benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)NCC[NH+]3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-16-2-6-18(7-3-16)22-28(25,26)19-8-4-17(5-9-19)20(24)21-10-11-23-12-14-27-15-13-23/h2-9,22H,10-15H2,1H3,(H,21,24)/p+1 |
| InChIKey | ZNALBJQOQILNAP-UHFFFAOYSA-O |
| XLogP | 0.44 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |