C30H37N3O4S — CID 2347604
N-[2-[[2-(4-tert-butyl-2,6-dimethylphenyl)acetyl]amino]ethyl]-4-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 2347604) has the molecular formula C30H37N3O4S and a molecular weight of 535.71 g/mol. Its IUPAC name is N-[2-[[2-(4-tert-butyl-2,6-dimethylphenyl)acetyl]amino]ethyl]-4-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-[[2-(4-tert-butyl-2,6-dimethylphenyl)acetyl]amino]ethyl]-4-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2347604 |
| Molecular Formula | C30H37N3O4S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | N-[2-[[2-(4-tert-butyl-2,6-dimethylphenyl)acetyl]amino]ethyl]-4-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)NCCNC(=O)Cc3c(C)cc(C(C)(C)C)cc3C)cc2)cc1 |
| InChI | InChI=1S/C30H37N3O4S/c1-20-7-11-25(12-8-20)33-38(36,37)26-13-9-23(10-14-26)29(35)32-16-15-31-28(34)19-27-21(2)17-24(18-22(27)3)30(4,5)6/h7-14,17-18,33H,15-16,19H2,1-6H3,(H,31,34)(H,32,35) |
| InChIKey | MAQRUSCUMYLWSY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|